C34H27NO3S — CID 73057636
3-[1-(4-methylphenyl)sulfonyl-3-phenylindol-2-yl]-1-naphthalen-1-ylpropan-1-one (PubChem CID 73057636) has the molecular formula C34H27NO3S and a molecular weight of 529.66 g/mol. Its IUPAC name is 3-[1-(4-methylphenyl)sulfonyl-3-phenylindol-2-yl]-1-naphthalen-1-ylpropan-1-one.
| Compound Name | 3-[1-(4-methylphenyl)sulfonyl-3-phenylindol-2-yl]-1-naphthalen-1-ylpropan-1-one |
|---|---|
| PubChem CID | 73057636 |
| Molecular Formula | C34H27NO3S |
| Molecular Weight | 529.66 g/mol |
| Exact Mass | 529.17 |
| IUPAC Name | 3-[1-(4-methylphenyl)sulfonyl-3-phenylindol-2-yl]-1-naphthalen-1-ylpropan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)n2c(CCC(=O)c3cccc4ccccc34)c(-c3ccccc3)c3ccccc32)cc1 |
| InChI | InChI=1S/C34H27NO3S/c1-24-18-20-27(21-19-24)39(37,38)35-31-17-8-7-15-30(31)34(26-11-3-2-4-12-26)32(35)22-23-33(36)29-16-9-13-25-10-5-6-14-28(25)29/h2-21H,22-23H2,1H3 |
| InChIKey | JCPOHNIHXQBCKO-UHFFFAOYSA-N |
| XLogP | 7.82 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.66 |
| LogP ≤ 5 | 7.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |