C29H25NO3S — CID 162398288
2-(4-methoxyphenyl)-4-methyl-1-(4-methylphenyl)sulfonyl-3-phenylindole (PubChem CID 162398288) has the molecular formula C29H25NO3S and a molecular weight of 467.59 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)-4-methyl-1-(4-methylphenyl)sulfonyl-3-phenylindole.
| Compound Name | 2-(4-methoxyphenyl)-4-methyl-1-(4-methylphenyl)sulfonyl-3-phenylindole |
|---|---|
| PubChem CID | 162398288 |
| Molecular Formula | C29H25NO3S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 2-(4-methoxyphenyl)-4-methyl-1-(4-methylphenyl)sulfonyl-3-phenylindole |
| SMILES | COc1ccc(-c2c(-c3ccccc3)c3c(C)cccc3n2S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C29H25NO3S/c1-20-12-18-25(19-13-20)34(31,32)30-26-11-7-8-21(2)27(26)28(22-9-5-4-6-10-22)29(30)23-14-16-24(33-3)17-15-23/h4-19H,1-3H3 |
| InChIKey | JRRQZVZGJXIKAM-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |