C24H20ClN3O5S — CID 139995122
ethyl 3-amino-4-[[1-(benzenesulfonyl)-5-chloroindole-2-carbonyl]amino]benzoate (PubChem CID 139995122) has the molecular formula C24H20ClN3O5S and a molecular weight of 497.96 g/mol. Its IUPAC name is ethyl 3-amino-4-[[1-(benzenesulfonyl)-5-chloroindole-2-carbonyl]amino]benzoate.
| Compound Name | ethyl 3-amino-4-[[1-(benzenesulfonyl)-5-chloroindole-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 139995122 |
| Molecular Formula | C24H20ClN3O5S |
| Molecular Weight | 497.96 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | ethyl 3-amino-4-[[1-(benzenesulfonyl)-5-chloroindole-2-carbonyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccc(NC(=O)c2cc3cc(Cl)ccc3n2S(=O)(=O)c2ccccc2)c(N)c1 |
| InChI | InChI=1S/C24H20ClN3O5S/c1-2-33-24(30)15-8-10-20(19(26)13-15)27-23(29)22-14-16-12-17(25)9-11-21(16)28(22)34(31,32)18-6-4-3-5-7-18/h3-14H,2,26H2,1H3,(H,27,29) |
| InChIKey | PLAYBEHPHLVCMH-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 120.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.96 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|