C27H32ClNO5S — CID 175924943
ethyl 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethyl-4-(4-methylphenyl)sulfonylpyrrole-2-carboxylate (PubChem CID 175924943) has the molecular formula C27H32ClNO5S and a molecular weight of 518.08 g/mol. Its IUPAC name is ethyl 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethyl-4-(4-methylphenyl)sulfonylpyrrole-2-carboxylate.
| Compound Name | ethyl 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethyl-4-(4-methylphenyl)sulfonylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 175924943 |
| Molecular Formula | C27H32ClNO5S |
| Molecular Weight | 518.08 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | ethyl 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethyl-4-(4-methylphenyl)sulfonylpyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1c(C)c(S(=O)(=O)c2ccc(C)cc2)c(C)n1CCCOc1cc(C)c(Cl)c(C)c1 |
| InChI | InChI=1S/C27H32ClNO5S/c1-7-33-27(30)25-20(5)26(35(31,32)23-11-9-17(2)10-12-23)21(6)29(25)13-8-14-34-22-15-18(3)24(28)19(4)16-22/h9-12,15-16H,7-8,13-14H2,1-6H3 |
| InChIKey | KMCRZKXDGXARAA-UHFFFAOYSA-N |
| XLogP | 6.16 |
| TPSA | 74.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.08 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|