C28H28ClNO3S — CID 167092572
1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethyl-4-naphthalen-1-ylsulfanylpyrrole-2-carboxylic acid (PubChem CID 167092572) has the molecular formula C28H28ClNO3S and a molecular weight of 494.06 g/mol. Its IUPAC name is 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethyl-4-naphthalen-1-ylsulfanylpyrrole-2-carboxylic acid.
| Compound Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethyl-4-naphthalen-1-ylsulfanylpyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 167092572 |
| Molecular Formula | C28H28ClNO3S |
| Molecular Weight | 494.06 g/mol |
| Exact Mass | 493.15 |
| IUPAC Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3,5-dimethyl-4-naphthalen-1-ylsulfanylpyrrole-2-carboxylic acid |
| SMILES | Cc1cc(OCCCn2c(C)c(Sc3cccc4ccccc34)c(C)c2C(=O)O)cc(C)c1Cl |
| InChI | InChI=1S/C28H28ClNO3S/c1-17-15-22(16-18(2)25(17)29)33-14-8-13-30-20(4)27(19(3)26(30)28(31)32)34-24-12-7-10-21-9-5-6-11-23(21)24/h5-7,9-12,15-16H,8,13-14H2,1-4H3,(H,31,32) |
| InChIKey | ABVCBAOJGWUOBN-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.06 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|