C22H23ClN2O5 — CID 155988662
1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3-ethyl-5-nitroindole-2-carboxylic acid (PubChem CID 155988662) has the molecular formula C22H23ClN2O5 and a molecular weight of 430.89 g/mol. Its IUPAC name is 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3-ethyl-5-nitroindole-2-carboxylic acid.
| Compound Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3-ethyl-5-nitroindole-2-carboxylic acid |
|---|---|
| PubChem CID | 155988662 |
| Molecular Formula | C22H23ClN2O5 |
| Molecular Weight | 430.89 g/mol |
| Exact Mass | 430.13 |
| IUPAC Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-3-ethyl-5-nitroindole-2-carboxylic acid |
| SMILES | CCc1c(C(=O)O)n(CCCOc2cc(C)c(Cl)c(C)c2)c2ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C22H23ClN2O5/c1-4-17-18-12-15(25(28)29)6-7-19(18)24(21(17)22(26)27)8-5-9-30-16-10-13(2)20(23)14(3)11-16/h6-7,10-12H,4-5,8-9H2,1-3H3,(H,26,27) |
| InChIKey | DOFALLDICVEQJK-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.89 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|