C26H25ClN2O4S — CID 175655652
N-(benzenesulfonyl)-1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indole-2-carboxamide (PubChem CID 175655652) has the molecular formula C26H25ClN2O4S and a molecular weight of 497.02 g/mol. Its IUPAC name is N-(benzenesulfonyl)-1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indole-2-carboxamide.
| Compound Name | N-(benzenesulfonyl)-1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indole-2-carboxamide |
|---|---|
| PubChem CID | 175655652 |
| Molecular Formula | C26H25ClN2O4S |
| Molecular Weight | 497.02 g/mol |
| Exact Mass | 496.12 |
| IUPAC Name | N-(benzenesulfonyl)-1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indole-2-carboxamide |
| SMILES | Cc1cc(OCCCn2c(C(=O)NS(=O)(=O)c3ccccc3)cc3ccccc32)cc(C)c1Cl |
| InChI | InChI=1S/C26H25ClN2O4S/c1-18-15-21(16-19(2)25(18)27)33-14-8-13-29-23-12-7-6-9-20(23)17-24(29)26(30)28-34(31,32)22-10-4-3-5-11-22/h3-7,9-12,15-17H,8,13-14H2,1-2H3,(H,28,30) |
| InChIKey | VLVSPJMCLFSZMN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.02 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|