C20H20ClN5O — CID 141472113
1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-(2H-tetrazol-5-yl)indole (PubChem CID 141472113) has the molecular formula C20H20ClN5O and a molecular weight of 381.87 g/mol. Its IUPAC name is 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-(2H-tetrazol-5-yl)indole.
| Compound Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-(2H-tetrazol-5-yl)indole |
|---|---|
| PubChem CID | 141472113 |
| Molecular Formula | C20H20ClN5O |
| Molecular Weight | 381.87 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-(2H-tetrazol-5-yl)indole |
| SMILES | Cc1cc(OCCCn2c(-c3nn[nH]n3)cc3ccccc32)cc(C)c1Cl |
| InChI | InChI=1S/C20H20ClN5O/c1-13-10-16(11-14(2)19(13)21)27-9-5-8-26-17-7-4-3-6-15(17)12-18(26)20-22-24-25-23-20/h3-4,6-7,10-12H,5,8-9H2,1-2H3,(H,22,23,24,25) |
| InChIKey | ASCZPMWEWMHTOB-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.87 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|