C27H24ClN3O4S — CID 175657554
1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-(4-cyanophenyl)sulfonylindole-2-carboxamide (PubChem CID 175657554) has the molecular formula C27H24ClN3O4S and a molecular weight of 522.03 g/mol. Its IUPAC name is 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-(4-cyanophenyl)sulfonylindole-2-carboxamide.
| Compound Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-(4-cyanophenyl)sulfonylindole-2-carboxamide |
|---|---|
| PubChem CID | 175657554 |
| Molecular Formula | C27H24ClN3O4S |
| Molecular Weight | 522.03 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-N-(4-cyanophenyl)sulfonylindole-2-carboxamide |
| SMILES | Cc1cc(OCCCn2c(C(=O)NS(=O)(=O)c3ccc(C#N)cc3)cc3ccccc32)cc(C)c1Cl |
| InChI | InChI=1S/C27H24ClN3O4S/c1-18-14-22(15-19(2)26(18)28)35-13-5-12-31-24-7-4-3-6-21(24)16-25(31)27(32)30-36(33,34)23-10-8-20(17-29)9-11-23/h3-4,6-11,14-16H,5,12-13H2,1-2H3,(H,30,32) |
| InChIKey | WWEZFRHYBCGSMM-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 101.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.03 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|