C17H16ClNO2 — CID 22683271
4-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]benzonitrile (PubChem CID 22683271) has the molecular formula C17H16ClNO2 and a molecular weight of 301.77 g/mol. Its IUPAC name is 4-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]benzonitrile.
| Compound Name | 4-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]benzonitrile |
|---|---|
| PubChem CID | 22683271 |
| Molecular Formula | C17H16ClNO2 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 4-[2-(4-chloro-3,5-dimethylphenoxy)ethoxy]benzonitrile |
| SMILES | Cc1cc(OCCOc2ccc(C#N)cc2)cc(C)c1Cl |
| InChI | InChI=1S/C17H16ClNO2/c1-12-9-16(10-13(2)17(12)18)21-8-7-20-15-5-3-14(11-19)4-6-15/h3-6,9-10H,7-8H2,1-2H3 |
| InChIKey | JGSYSINGHLKXDX-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|