C27H27ClN2O5S — CID 141472160
N-(benzenesulfonyl)-2-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indol-6-yl]oxyacetamide (PubChem CID 141472160) has the molecular formula C27H27ClN2O5S and a molecular weight of 527.04 g/mol. Its IUPAC name is N-(benzenesulfonyl)-2-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indol-6-yl]oxyacetamide.
| Compound Name | N-(benzenesulfonyl)-2-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indol-6-yl]oxyacetamide |
|---|---|
| PubChem CID | 141472160 |
| Molecular Formula | C27H27ClN2O5S |
| Molecular Weight | 527.04 g/mol |
| Exact Mass | 526.13 |
| IUPAC Name | N-(benzenesulfonyl)-2-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indol-6-yl]oxyacetamide |
| SMILES | Cc1cc(OCCCn2ccc3ccc(OCC(=O)NS(=O)(=O)c4ccccc4)cc32)cc(C)c1Cl |
| InChI | InChI=1S/C27H27ClN2O5S/c1-19-15-23(16-20(2)27(19)28)34-14-6-12-30-13-11-21-9-10-22(17-25(21)30)35-18-26(31)29-36(32,33)24-7-4-3-5-8-24/h3-5,7-11,13,15-17H,6,12,14,18H2,1-2H3,(H,29,31) |
| InChIKey | IBGNIUSQGUDYDL-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.04 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|