C21H21ClN2O2 — CID 141472141
2-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indol-6-yl]oxyacetonitrile (PubChem CID 141472141) has the molecular formula C21H21ClN2O2 and a molecular weight of 368.86 g/mol. Its IUPAC name is 2-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indol-6-yl]oxyacetonitrile.
| Compound Name | 2-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indol-6-yl]oxyacetonitrile |
|---|---|
| PubChem CID | 141472141 |
| Molecular Formula | C21H21ClN2O2 |
| Molecular Weight | 368.86 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 2-[1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]indol-6-yl]oxyacetonitrile |
| SMILES | Cc1cc(OCCCn2ccc3ccc(OCC#N)cc32)cc(C)c1Cl |
| InChI | InChI=1S/C21H21ClN2O2/c1-15-12-19(13-16(2)21(15)22)25-10-3-8-24-9-6-17-4-5-18(14-20(17)24)26-11-7-23/h4-6,9,12-14H,3,8,10-11H2,1-2H3 |
| InChIKey | NXNDXLXWGPBPFJ-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 47.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.86 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|