C17H15ClN2O3S — CID 86997837
N-(3-chlorophenyl)sulfonyl-3-indol-1-ylpropanamide (PubChem CID 86997837) has the molecular formula C17H15ClN2O3S and a molecular weight of 362.84 g/mol. Its IUPAC name is N-(3-chlorophenyl)sulfonyl-3-indol-1-ylpropanamide.
| Compound Name | N-(3-chlorophenyl)sulfonyl-3-indol-1-ylpropanamide |
|---|---|
| PubChem CID | 86997837 |
| Molecular Formula | C17H15ClN2O3S |
| Molecular Weight | 362.84 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | N-(3-chlorophenyl)sulfonyl-3-indol-1-ylpropanamide |
| SMILES | O=C(CCn1ccc2ccccc21)NS(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C17H15ClN2O3S/c18-14-5-3-6-15(12-14)24(22,23)19-17(21)9-11-20-10-8-13-4-1-2-7-16(13)20/h1-8,10,12H,9,11H2,(H,19,21) |
| InChIKey | HEDAEKFEEGPQOT-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.84 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |