C14H18N2O5S2 — CID 75386486
3-indol-1-yl-N-(2-methylsulfonylethylsulfonyl)propanamide (PubChem CID 75386486) has the molecular formula C14H18N2O5S2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 3-indol-1-yl-N-(2-methylsulfonylethylsulfonyl)propanamide.
| Compound Name | 3-indol-1-yl-N-(2-methylsulfonylethylsulfonyl)propanamide |
|---|---|
| PubChem CID | 75386486 |
| Molecular Formula | C14H18N2O5S2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 3-indol-1-yl-N-(2-methylsulfonylethylsulfonyl)propanamide |
| SMILES | CS(=O)(=O)CCS(=O)(=O)NC(=O)CCn1ccc2ccccc21 |
| InChI | InChI=1S/C14H18N2O5S2/c1-22(18,19)10-11-23(20,21)15-14(17)7-9-16-8-6-12-4-2-3-5-13(12)16/h2-6,8H,7,9-11H2,1H3,(H,15,17) |
| InChIKey | YWSZYIHQJMIXEO-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |