C18H22N2O — CID 18273092
N-(3-ethylpent-1-yn-3-yl)-3-indol-1-ylpropanamide (PubChem CID 18273092) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is N-(3-ethylpent-1-yn-3-yl)-3-indol-1-ylpropanamide.
| Compound Name | N-(3-ethylpent-1-yn-3-yl)-3-indol-1-ylpropanamide |
|---|---|
| PubChem CID | 18273092 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | N-(3-ethylpent-1-yn-3-yl)-3-indol-1-ylpropanamide |
| SMILES | C#CC(CC)(CC)NC(=O)CCn1ccc2ccccc21 |
| InChI | InChI=1S/C18H22N2O/c1-4-18(5-2,6-3)19-17(21)12-14-20-13-11-15-9-7-8-10-16(15)20/h1,7-11,13H,5-6,12,14H2,2-3H3,(H,19,21) |
| InChIKey | AHWFBHJLQWWZIJ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|