C14H13ClN2O4S — CID 95301732
2-(4-chloro-3-methylphenoxy)-N-pyridin-3-ylsulfonylacetamide (PubChem CID 95301732) has the molecular formula C14H13ClN2O4S and a molecular weight of 340.79 g/mol. Its IUPAC name is 2-(4-chloro-3-methylphenoxy)-N-pyridin-3-ylsulfonylacetamide.
| Compound Name | 2-(4-chloro-3-methylphenoxy)-N-pyridin-3-ylsulfonylacetamide |
|---|---|
| PubChem CID | 95301732 |
| Molecular Formula | C14H13ClN2O4S |
| Molecular Weight | 340.79 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 2-(4-chloro-3-methylphenoxy)-N-pyridin-3-ylsulfonylacetamide |
| SMILES | Cc1cc(OCC(=O)NS(=O)(=O)c2cccnc2)ccc1Cl |
| InChI | InChI=1S/C14H13ClN2O4S/c1-10-7-11(4-5-13(10)15)21-9-14(18)17-22(19,20)12-3-2-6-16-8-12/h2-8H,9H2,1H3,(H,17,18) |
| InChIKey | IWDZOOAWCVEYPM-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.79 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |