C34H40ClN3O6S2 — CID 132769782
1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2,3-dimethyl-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]sulfonylindole-4-carboxamide (PubChem CID 132769782) has the molecular formula C34H40ClN3O6S2 and a molecular weight of 686.30 g/mol. Its IUPAC name is 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2,3-dimethyl-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]sulfonylindole-4-carboxamide.
| Compound Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2,3-dimethyl-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]sulfonylindole-4-carboxamide |
|---|---|
| PubChem CID | 132769782 |
| Molecular Formula | C34H40ClN3O6S2 |
| Molecular Weight | 686.30 g/mol |
| Exact Mass | 685.20 |
| IUPAC Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2,3-dimethyl-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]sulfonylindole-4-carboxamide |
| SMILES | Cc1cc(OCCCn2c(C)c(C)c3c(C(=O)NS(=O)(=O)c4ccc(S(=O)(=O)N5CCCC(C)C5)cc4)cccc32)cc(C)c1Cl |
| InChI | InChI=1S/C34H40ClN3O6S2/c1-22-9-7-16-37(21-22)46(42,43)29-14-12-28(13-15-29)45(40,41)36-34(39)30-10-6-11-31-32(30)25(4)26(5)38(31)17-8-18-44-27-19-23(2)33(35)24(3)20-27/h6,10-15,19-20,22H,7-9,16-18,21H2,1-5H3,(H,36,39) |
| InChIKey | CIXFMLCPPFKLEL-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 114.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.30 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|