C21H25ClN2O3S — CID 42908081
N-(2-chloro-4,6-dimethylphenyl)-4-(3-methylpiperidin-1-yl)sulfonylbenzamide (PubChem CID 42908081) has the molecular formula C21H25ClN2O3S and a molecular weight of 420.96 g/mol. Its IUPAC name is N-(2-chloro-4,6-dimethylphenyl)-4-(3-methylpiperidin-1-yl)sulfonylbenzamide.
| Compound Name | N-(2-chloro-4,6-dimethylphenyl)-4-(3-methylpiperidin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 42908081 |
| Molecular Formula | C21H25ClN2O3S |
| Molecular Weight | 420.96 g/mol |
| Exact Mass | 420.13 |
| IUPAC Name | N-(2-chloro-4,6-dimethylphenyl)-4-(3-methylpiperidin-1-yl)sulfonylbenzamide |
| SMILES | Cc1cc(C)c(NC(=O)c2ccc(S(=O)(=O)N3CCCC(C)C3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C21H25ClN2O3S/c1-14-5-4-10-24(13-14)28(26,27)18-8-6-17(7-9-18)21(25)23-20-16(3)11-15(2)12-19(20)22/h6-9,11-12,14H,4-5,10,13H2,1-3H3,(H,23,25) |
| InChIKey | RIYCYIWWSNUVEZ-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.96 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |