C20H22Cl2N2O3S — CID 3972572
4-chloro-N-(2-chloro-4,6-dimethylphenyl)-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 3972572) has the molecular formula C20H22Cl2N2O3S and a molecular weight of 441.38 g/mol. Its IUPAC name is 4-chloro-N-(2-chloro-4,6-dimethylphenyl)-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | 4-chloro-N-(2-chloro-4,6-dimethylphenyl)-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 3972572 |
| Molecular Formula | C20H22Cl2N2O3S |
| Molecular Weight | 441.38 g/mol |
| Exact Mass | 440.07 |
| IUPAC Name | 4-chloro-N-(2-chloro-4,6-dimethylphenyl)-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | Cc1cc(C)c(NC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCCC3)c2)c(Cl)c1 |
| InChI | InChI=1S/C20H22Cl2N2O3S/c1-13-10-14(2)19(17(22)11-13)23-20(25)15-6-7-16(21)18(12-15)28(26,27)24-8-4-3-5-9-24/h6-7,10-12H,3-5,8-9H2,1-2H3,(H,23,25) |
| InChIKey | FHEPPNOQTRGRQR-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.38 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |