C24H23ClN2O2 — CID 16999939
1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-[(E)-2-(furan-2-yl)ethenyl]benzimidazole (PubChem CID 16999939) has the molecular formula C24H23ClN2O2 and a molecular weight of 406.91 g/mol. Its IUPAC name is 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-[(E)-2-(furan-2-yl)ethenyl]benzimidazole.
| Compound Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-[(E)-2-(furan-2-yl)ethenyl]benzimidazole |
|---|---|
| PubChem CID | 16999939 |
| Molecular Formula | C24H23ClN2O2 |
| Molecular Weight | 406.91 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 1-[3-(4-chloro-3,5-dimethylphenoxy)propyl]-2-[(E)-2-(furan-2-yl)ethenyl]benzimidazole |
| SMILES | Cc1cc(OCCCn2c(/C=C/c3ccco3)nc3ccccc32)cc(C)c1Cl |
| InChI | InChI=1S/C24H23ClN2O2/c1-17-15-20(16-18(2)24(17)25)29-14-6-12-27-22-9-4-3-8-21(22)26-23(27)11-10-19-7-5-13-28-19/h3-5,7-11,13,15-16H,6,12,14H2,1-2H3/b11-10+ |
| InChIKey | MTRKCLIDAQUJNT-ZHACJKMWSA-N |
| XLogP | 6.54 |
| TPSA | 40.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.91 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|