C25H26N2O2 — CID 16999930
2-[(E)-2-(furan-2-yl)ethenyl]-1-[3-(2-propan-2-ylphenoxy)propyl]benzimidazole (PubChem CID 16999930) has the molecular formula C25H26N2O2 and a molecular weight of 386.50 g/mol. Its IUPAC name is 2-[(E)-2-(furan-2-yl)ethenyl]-1-[3-(2-propan-2-ylphenoxy)propyl]benzimidazole.
| Compound Name | 2-[(E)-2-(furan-2-yl)ethenyl]-1-[3-(2-propan-2-ylphenoxy)propyl]benzimidazole |
|---|---|
| PubChem CID | 16999930 |
| Molecular Formula | C25H26N2O2 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 2-[(E)-2-(furan-2-yl)ethenyl]-1-[3-(2-propan-2-ylphenoxy)propyl]benzimidazole |
| SMILES | CC(C)c1ccccc1OCCCn1c(/C=C/c2ccco2)nc2ccccc21 |
| InChI | InChI=1S/C25H26N2O2/c1-19(2)21-10-3-6-13-24(21)29-18-8-16-27-23-12-5-4-11-22(23)26-25(27)15-14-20-9-7-17-28-20/h3-7,9-15,17,19H,8,16,18H2,1-2H3/b15-14+ |
| InChIKey | WJAWQBMUPHSSGB-CCEZHUSRSA-N |
| XLogP | 6.39 |
| TPSA | 40.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|