C26H28N2O2 — CID 16999945
1-[3-(4-butan-2-ylphenoxy)propyl]-2-[(E)-2-(furan-2-yl)ethenyl]benzimidazole (PubChem CID 16999945) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is 1-[3-(4-butan-2-ylphenoxy)propyl]-2-[(E)-2-(furan-2-yl)ethenyl]benzimidazole.
| Compound Name | 1-[3-(4-butan-2-ylphenoxy)propyl]-2-[(E)-2-(furan-2-yl)ethenyl]benzimidazole |
|---|---|
| PubChem CID | 16999945 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | 1-[3-(4-butan-2-ylphenoxy)propyl]-2-[(E)-2-(furan-2-yl)ethenyl]benzimidazole |
| SMILES | CCC(C)c1ccc(OCCCn2c(/C=C/c3ccco3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C26H28N2O2/c1-3-20(2)21-11-13-23(14-12-21)30-19-7-17-28-25-10-5-4-9-24(25)27-26(28)16-15-22-8-6-18-29-22/h4-6,8-16,18,20H,3,7,17,19H2,1-2H3/b16-15+ |
| InChIKey | ZQDCUYHRLTYYQD-FOCLMDBBSA-N |
| XLogP | 6.78 |
| TPSA | 40.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|