C27H27ClN2O — CID 16999834
2-[(E)-2-(4-chlorophenyl)ethenyl]-1-[4-(3,5-dimethylphenoxy)butyl]benzimidazole (PubChem CID 16999834) has the molecular formula C27H27ClN2O and a molecular weight of 430.98 g/mol. Its IUPAC name is 2-[(E)-2-(4-chlorophenyl)ethenyl]-1-[4-(3,5-dimethylphenoxy)butyl]benzimidazole.
| Compound Name | 2-[(E)-2-(4-chlorophenyl)ethenyl]-1-[4-(3,5-dimethylphenoxy)butyl]benzimidazole |
|---|---|
| PubChem CID | 16999834 |
| Molecular Formula | C27H27ClN2O |
| Molecular Weight | 430.98 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 2-[(E)-2-(4-chlorophenyl)ethenyl]-1-[4-(3,5-dimethylphenoxy)butyl]benzimidazole |
| SMILES | Cc1cc(C)cc(OCCCCn2c(/C=C/c3ccc(Cl)cc3)nc3ccccc32)c1 |
| InChI | InChI=1S/C27H27ClN2O/c1-20-17-21(2)19-24(18-20)31-16-6-5-15-30-26-8-4-3-7-25(26)29-27(30)14-11-22-9-12-23(28)13-10-22/h3-4,7-14,17-19H,5-6,15-16H2,1-2H3/b14-11+ |
| InChIKey | QMHKGNCLFDVVHL-SDNWHVSQSA-N |
| XLogP | 7.34 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.98 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|