C30H34N2O2 — CID 16999729
1-[4-(4-tert-butylphenoxy)butyl]-2-[(E)-2-(4-methoxyphenyl)ethenyl]benzimidazole (PubChem CID 16999729) has the molecular formula C30H34N2O2 and a molecular weight of 454.61 g/mol. Its IUPAC name is 1-[4-(4-tert-butylphenoxy)butyl]-2-[(E)-2-(4-methoxyphenyl)ethenyl]benzimidazole.
| Compound Name | 1-[4-(4-tert-butylphenoxy)butyl]-2-[(E)-2-(4-methoxyphenyl)ethenyl]benzimidazole |
|---|---|
| PubChem CID | 16999729 |
| Molecular Formula | C30H34N2O2 |
| Molecular Weight | 454.61 g/mol |
| Exact Mass | 454.26 |
| IUPAC Name | 1-[4-(4-tert-butylphenoxy)butyl]-2-[(E)-2-(4-methoxyphenyl)ethenyl]benzimidazole |
| SMILES | COc1ccc(/C=C/c2nc3ccccc3n2CCCCOc2ccc(C(C)(C)C)cc2)cc1 |
| InChI | InChI=1S/C30H34N2O2/c1-30(2,3)24-14-18-26(19-15-24)34-22-8-7-21-32-28-10-6-5-9-27(28)31-29(32)20-13-23-11-16-25(33-4)17-12-23/h5-6,9-20H,7-8,21-22H2,1-4H3/b20-13+ |
| InChIKey | SEXGTRDYDSZJMX-DEDYPNTBSA-N |
| XLogP | 7.37 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.61 |
| LogP ≤ 5 | 7.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|