C26H25ClN2O — CID 16999796
2-[(E)-2-(4-chlorophenyl)ethenyl]-1-[2-(4-propan-2-ylphenoxy)ethyl]benzimidazole (PubChem CID 16999796) has the molecular formula C26H25ClN2O and a molecular weight of 416.95 g/mol. Its IUPAC name is 2-[(E)-2-(4-chlorophenyl)ethenyl]-1-[2-(4-propan-2-ylphenoxy)ethyl]benzimidazole.
| Compound Name | 2-[(E)-2-(4-chlorophenyl)ethenyl]-1-[2-(4-propan-2-ylphenoxy)ethyl]benzimidazole |
|---|---|
| PubChem CID | 16999796 |
| Molecular Formula | C26H25ClN2O |
| Molecular Weight | 416.95 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 2-[(E)-2-(4-chlorophenyl)ethenyl]-1-[2-(4-propan-2-ylphenoxy)ethyl]benzimidazole |
| SMILES | CC(C)c1ccc(OCCn2c(/C=C/c3ccc(Cl)cc3)nc3ccccc32)cc1 |
| InChI | InChI=1S/C26H25ClN2O/c1-19(2)21-10-14-23(15-11-21)30-18-17-29-25-6-4-3-5-24(25)28-26(29)16-9-20-7-12-22(27)13-8-20/h3-16,19H,17-18H2,1-2H3/b16-9+ |
| InChIKey | LCZWHPFZRKCSEY-CXUHLZMHSA-N |
| XLogP | 7.06 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.95 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |