C18H19ClN2O — CID 16995223
1-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-2-methylbenzimidazole (PubChem CID 16995223) has the molecular formula C18H19ClN2O and a molecular weight of 314.82 g/mol. Its IUPAC name is 1-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-2-methylbenzimidazole.
| Compound Name | 1-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-2-methylbenzimidazole |
|---|---|
| PubChem CID | 16995223 |
| Molecular Formula | C18H19ClN2O |
| Molecular Weight | 314.82 g/mol |
| Exact Mass | 314.12 |
| IUPAC Name | 1-[2-(4-chloro-3,5-dimethylphenoxy)ethyl]-2-methylbenzimidazole |
| SMILES | Cc1cc(OCCn2c(C)nc3ccccc32)cc(C)c1Cl |
| InChI | InChI=1S/C18H19ClN2O/c1-12-10-15(11-13(2)18(12)19)22-9-8-21-14(3)20-16-6-4-5-7-17(16)21/h4-7,10-11H,8-9H2,1-3H3 |
| InChIKey | IRJVXZNECWTZLD-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.82 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |