6-chloro-1-(4-methylphenyl)sulfonylindole-3-sulfonyl chloride

C15H11Cl2NO4S2 — CID 71305311

IUPAC6-chloro-1-(4-methylphenyl)sulfonylindole-3-sulfonyl chloride
SMILESCc1ccc(S(=O)(=O)n2cc(S(=O)(=O)Cl)c3ccc(Cl)cc32)cc1
InChIInChI=1S/C15H11Cl2NO4S2/c1-10-2-5-12(6-3-10)24(21,22)18-9-15(23(17,19)20)13-7-4-11(16)8-14(13)18/h2-9H,1H3
InChIKeyHSGLRNWSOFHYTP-UHFFFAOYSA-N
MW404.30 g/mol
LogP3.77
Rot. Bonds3

About 6-chloro-1-(4-methylphenyl)sulfonylindole-3-sulfonyl chloride

6-chloro-1-(4-methylphenyl)sulfonylindole-3-sulfonyl chloride (PubChem CID 71305311) has the molecular formula C15H11Cl2NO4S2 and a molecular weight of 404.30 g/mol. Its IUPAC name is 6-chloro-1-(4-methylphenyl)sulfonylindole-3-sulfonyl chloride.

Molecular Properties

Compound Name6-chloro-1-(4-methylphenyl)sulfonylindole-3-sulfonyl chloride
PubChem CID71305311
Molecular FormulaC15H11Cl2NO4S2
Molecular Weight404.30 g/mol
Exact Mass402.95
IUPAC Name6-chloro-1-(4-methylphenyl)sulfonylindole-3-sulfonyl chloride
SMILESCc1ccc(S(=O)(=O)n2cc(S(=O)(=O)Cl)c3ccc(Cl)cc32)cc1
InChIInChI=1S/C15H11Cl2NO4S2/c1-10-2-5-12(6-3-10)24(21,22)18-9-15(23(17,19)20)13-7-4-11(16)8-14(13)18/h2-9H,1H3
InChIKeyHSGLRNWSOFHYTP-UHFFFAOYSA-N
XLogP3.77
TPSA73.21 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500404.30
LogP ≤ 53.77
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze 6-chloro-1-(4-methylphenyl)sulfonylindole-3-sulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-chloro-1-(4-methylphenyl)sulfonylindole-3-sulfonyl chloride?
The IUPAC name of 6-chloro-1-(4-methylphenyl)sulfonylindole-3-sulfonyl chloride (CID 71305311) is 6-chloro-1-(4-methylphenyl)sulfonylindole-3-sulfonyl chloride.
What is the SMILES notation for 6-chloro-1-(4-methylphenyl)sulfonylindole-3-sulfonyl chloride?
The canonical SMILES for 6-chloro-1-(4-methylphenyl)sulfonylindole-3-sulfonyl chloride is Cc1ccc(S(=O)(=O)n2cc(S(=O)(=O)Cl)c3ccc(Cl)cc32)cc1.
What is the InChIKey of 6-chloro-1-(4-methylphenyl)sulfonylindole-3-sulfonyl chloride?
The InChIKey is HSGLRNWSOFHYTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl2NO4S2/c1-10-2-5-12(6-3-10)24(21,22)18-9-15(23(17,19)20)13-7-4-11(16)8-14(13)18/h2-9H,1H3.
What are the key properties of 6-chloro-1-(4-methylphenyl)sulfonylindole-3-sulfonyl chloride?
6-chloro-1-(4-methylphenyl)sulfonylindole-3-sulfonyl chloride has a molecular weight of 404.30 g/mol, XLogP of 3.77, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-1-(4-methylphenyl)sulfonylindole-3-sulfonyl chloride is sourced from PubChem (CID 71305311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).