C14H11ClN2O2S2 — CID 146509609
5-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine-3-thiol (PubChem CID 146509609) has the molecular formula C14H11ClN2O2S2 and a molecular weight of 338.84 g/mol. Its IUPAC name is 5-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine-3-thiol.
| Compound Name | 5-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine-3-thiol |
|---|---|
| PubChem CID | 146509609 |
| Molecular Formula | C14H11ClN2O2S2 |
| Molecular Weight | 338.84 g/mol |
| Exact Mass | 338.00 |
| IUPAC Name | 5-chloro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridine-3-thiol |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(S)c3cc(Cl)cnc32)cc1 |
| InChI | InChI=1S/C14H11ClN2O2S2/c1-9-2-4-11(5-3-9)21(18,19)17-8-13(20)12-6-10(15)7-16-14(12)17/h2-8,20H,1H3 |
| InChIKey | GUBMZYWEJBSHKP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 51.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.84 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|