C20H20IN3O3S — CID 135332485
5-[3-iodo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole (PubChem CID 135332485) has the molecular formula C20H20IN3O3S and a molecular weight of 509.37 g/mol. Its IUPAC name is 5-[3-iodo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole.
| Compound Name | 5-[3-iodo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
|---|---|
| PubChem CID | 135332485 |
| Molecular Formula | C20H20IN3O3S |
| Molecular Weight | 509.37 g/mol |
| Exact Mass | 509.03 |
| IUPAC Name | 5-[3-iodo-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]pyrrole |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(I)c3cc(N4CC5COCC5C4)cnc32)cc1 |
| InChI | InChI=1S/C20H20IN3O3S/c1-13-2-4-17(5-3-13)28(25,26)24-10-19(21)18-6-16(7-22-20(18)24)23-8-14-11-27-12-15(14)9-23/h2-7,10,14-15H,8-9,11-12H2,1H3 |
| InChIKey | KQDROMRXKDWSFC-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.37 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|