C18H18ClNO4S2 — CID 141426905
1-(benzenesulfonyl)-6-chloro-3-(3-methylsulfonylpropyl)indole (PubChem CID 141426905) has the molecular formula C18H18ClNO4S2 and a molecular weight of 411.93 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-6-chloro-3-(3-methylsulfonylpropyl)indole.
| Compound Name | 1-(benzenesulfonyl)-6-chloro-3-(3-methylsulfonylpropyl)indole |
|---|---|
| PubChem CID | 141426905 |
| Molecular Formula | C18H18ClNO4S2 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 1-(benzenesulfonyl)-6-chloro-3-(3-methylsulfonylpropyl)indole |
| SMILES | CS(=O)(=O)CCCc1cn(S(=O)(=O)c2ccccc2)c2cc(Cl)ccc12 |
| InChI | InChI=1S/C18H18ClNO4S2/c1-25(21,22)11-5-6-14-13-20(18-12-15(19)9-10-17(14)18)26(23,24)16-7-3-2-4-8-16/h2-4,7-10,12-13H,5-6,11H2,1H3 |
| InChIKey | FDYNGGXKGLUMLO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 73.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |