C14H13ClN2O2S2 — CID 11186879
2-[4-(3-chlorophenyl)sulfonylthieno[3,2-b]pyrrol-6-yl]ethanamine (PubChem CID 11186879) has the molecular formula C14H13ClN2O2S2 and a molecular weight of 340.86 g/mol. Its IUPAC name is 2-[4-(3-chlorophenyl)sulfonylthieno[3,2-b]pyrrol-6-yl]ethanamine.
| Compound Name | 2-[4-(3-chlorophenyl)sulfonylthieno[3,2-b]pyrrol-6-yl]ethanamine |
|---|---|
| PubChem CID | 11186879 |
| Molecular Formula | C14H13ClN2O2S2 |
| Molecular Weight | 340.86 g/mol |
| Exact Mass | 340.01 |
| IUPAC Name | 2-[4-(3-chlorophenyl)sulfonylthieno[3,2-b]pyrrol-6-yl]ethanamine |
| SMILES | NCCc1cn(S(=O)(=O)c2cccc(Cl)c2)c2ccsc12 |
| InChI | InChI=1S/C14H13ClN2O2S2/c15-11-2-1-3-12(8-11)21(18,19)17-9-10(4-6-16)14-13(17)5-7-20-14/h1-3,5,7-9H,4,6,16H2 |
| InChIKey | OPCUFDRPQYJKBS-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.86 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |