C13H12BrClN2O4S — CID 66924653
2-[5-bromo-1-(3-chlorophenyl)sulfonylpyrrol-3-yl]ethylcarbamic acid (PubChem CID 66924653) has the molecular formula C13H12BrClN2O4S and a molecular weight of 407.67 g/mol. Its IUPAC name is 2-[5-bromo-1-(3-chlorophenyl)sulfonylpyrrol-3-yl]ethylcarbamic acid.
| Compound Name | 2-[5-bromo-1-(3-chlorophenyl)sulfonylpyrrol-3-yl]ethylcarbamic acid |
|---|---|
| PubChem CID | 66924653 |
| Molecular Formula | C13H12BrClN2O4S |
| Molecular Weight | 407.67 g/mol |
| Exact Mass | 405.94 |
| IUPAC Name | 2-[5-bromo-1-(3-chlorophenyl)sulfonylpyrrol-3-yl]ethylcarbamic acid |
| SMILES | O=C(O)NCCc1cc(Br)n(S(=O)(=O)c2cccc(Cl)c2)c1 |
| InChI | InChI=1S/C13H12BrClN2O4S/c14-12-6-9(4-5-16-13(18)19)8-17(12)22(20,21)11-3-1-2-10(15)7-11/h1-3,6-8,16H,4-5H2,(H,18,19) |
| InChIKey | HTTPFOBZYQFFJT-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.67 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |