C16H10Br2F3NO2SSe — CID 175472341
2,6-dibromo-1-(4-methylphenyl)sulfonyl-3-(trifluoromethylselanyl)indole (PubChem CID 175472341) has the molecular formula C16H10Br2F3NO2SSe and a molecular weight of 576.09 g/mol. Its IUPAC name is 2,6-dibromo-1-(4-methylphenyl)sulfonyl-3-(trifluoromethylselanyl)indole.
| Compound Name | 2,6-dibromo-1-(4-methylphenyl)sulfonyl-3-(trifluoromethylselanyl)indole |
|---|---|
| PubChem CID | 175472341 |
| Molecular Formula | C16H10Br2F3NO2SSe |
| Molecular Weight | 576.09 g/mol |
| Exact Mass | 574.79 |
| IUPAC Name | 2,6-dibromo-1-(4-methylphenyl)sulfonyl-3-(trifluoromethylselanyl)indole |
| SMILES | Cc1ccc(S(=O)(=O)n2c(Br)c([Se]C(F)(F)F)c3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C16H10Br2F3NO2SSe/c1-9-2-5-11(6-3-9)25(23,24)22-13-8-10(17)4-7-12(13)14(15(22)18)26-16(19,20)21/h2-8H,1H3 |
| InChIKey | RPLWQYYCYIFKKT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.09 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|