C21H21BrN2O2S — CID 66603307
8-bromo-10-(4-methylphenyl)sulfonyl-1,2,3,5,11,11a-hexahydroindolizino[7,6-b]indole (PubChem CID 66603307) has the molecular formula C21H21BrN2O2S and a molecular weight of 445.38 g/mol. Its IUPAC name is 8-bromo-10-(4-methylphenyl)sulfonyl-1,2,3,5,11,11a-hexahydroindolizino[7,6-b]indole.
| Compound Name | 8-bromo-10-(4-methylphenyl)sulfonyl-1,2,3,5,11,11a-hexahydroindolizino[7,6-b]indole |
|---|---|
| PubChem CID | 66603307 |
| Molecular Formula | C21H21BrN2O2S |
| Molecular Weight | 445.38 g/mol |
| Exact Mass | 444.05 |
| IUPAC Name | 8-bromo-10-(4-methylphenyl)sulfonyl-1,2,3,5,11,11a-hexahydroindolizino[7,6-b]indole |
| SMILES | Cc1ccc(S(=O)(=O)n2c3c(c4ccc(Br)cc42)CN2CCCC2C3)cc1 |
| InChI | InChI=1S/C21H21BrN2O2S/c1-14-4-7-17(8-5-14)27(25,26)24-20-11-15(22)6-9-18(20)19-13-23-10-2-3-16(23)12-21(19)24/h4-9,11,16H,2-3,10,12-13H2,1H3 |
| InChIKey | UVIIPSOJHZMZND-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.38 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |