C26H25BrN2O2S — CID 122385808
2-[1-[(2-bromophenyl)methyl]pyrrolidin-2-yl]-1-(4-methylphenyl)sulfonylindole (PubChem CID 122385808) has the molecular formula C26H25BrN2O2S and a molecular weight of 509.47 g/mol. Its IUPAC name is 2-[1-[(2-bromophenyl)methyl]pyrrolidin-2-yl]-1-(4-methylphenyl)sulfonylindole.
| Compound Name | 2-[1-[(2-bromophenyl)methyl]pyrrolidin-2-yl]-1-(4-methylphenyl)sulfonylindole |
|---|---|
| PubChem CID | 122385808 |
| Molecular Formula | C26H25BrN2O2S |
| Molecular Weight | 509.47 g/mol |
| Exact Mass | 508.08 |
| IUPAC Name | 2-[1-[(2-bromophenyl)methyl]pyrrolidin-2-yl]-1-(4-methylphenyl)sulfonylindole |
| SMILES | Cc1ccc(S(=O)(=O)n2c(C3CCCN3Cc3ccccc3Br)cc3ccccc32)cc1 |
| InChI | InChI=1S/C26H25BrN2O2S/c1-19-12-14-22(15-13-19)32(30,31)29-24-10-5-3-7-20(24)17-26(29)25-11-6-16-28(25)18-21-8-2-4-9-23(21)27/h2-5,7-10,12-15,17,25H,6,11,16,18H2,1H3 |
| InChIKey | ITWZHPFMSQIDLX-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.47 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |