C16H15BrN2O2S — CID 123815720
6-bromo-3-ethyl-1-(4-methylphenyl)sulfonylpyrrolo[3,2-c]pyridine (PubChem CID 123815720) has the molecular formula C16H15BrN2O2S and a molecular weight of 379.28 g/mol. Its IUPAC name is 6-bromo-3-ethyl-1-(4-methylphenyl)sulfonylpyrrolo[3,2-c]pyridine.
| Compound Name | 6-bromo-3-ethyl-1-(4-methylphenyl)sulfonylpyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 123815720 |
| Molecular Formula | C16H15BrN2O2S |
| Molecular Weight | 379.28 g/mol |
| Exact Mass | 378.00 |
| IUPAC Name | 6-bromo-3-ethyl-1-(4-methylphenyl)sulfonylpyrrolo[3,2-c]pyridine |
| SMILES | CCc1cn(S(=O)(=O)c2ccc(C)cc2)c2cc(Br)ncc12 |
| InChI | InChI=1S/C16H15BrN2O2S/c1-3-12-10-19(15-8-16(17)18-9-14(12)15)22(20,21)13-6-4-11(2)5-7-13/h4-10H,3H2,1-2H3 |
| InChIKey | CWSZTAVKFRRMHO-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.28 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|