C18H16BrF2NO2S — CID 57386816
5-(bromomethyl)-3-(2,2-difluoroethyl)-1-(4-methylphenyl)sulfonylindole (PubChem CID 57386816) has the molecular formula C18H16BrF2NO2S and a molecular weight of 428.30 g/mol. Its IUPAC name is 5-(bromomethyl)-3-(2,2-difluoroethyl)-1-(4-methylphenyl)sulfonylindole.
| Compound Name | 5-(bromomethyl)-3-(2,2-difluoroethyl)-1-(4-methylphenyl)sulfonylindole |
|---|---|
| PubChem CID | 57386816 |
| Molecular Formula | C18H16BrF2NO2S |
| Molecular Weight | 428.30 g/mol |
| Exact Mass | 427.01 |
| IUPAC Name | 5-(bromomethyl)-3-(2,2-difluoroethyl)-1-(4-methylphenyl)sulfonylindole |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(CC(F)F)c3cc(CBr)ccc32)cc1 |
| InChI | InChI=1S/C18H16BrF2NO2S/c1-12-2-5-15(6-3-12)25(23,24)22-11-14(9-18(20)21)16-8-13(10-19)4-7-17(16)22/h2-8,11,18H,9-10H2,1H3 |
| InChIKey | LPAKUHPCNAPNMW-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.30 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|