C25H24Cl2N2O3S — CID 155268561
3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)indol-5-yl]oxyaniline (PubChem CID 155268561) has the molecular formula C25H24Cl2N2O3S and a molecular weight of 503.45 g/mol. Its IUPAC name is 3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)indol-5-yl]oxyaniline.
| Compound Name | 3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)indol-5-yl]oxyaniline |
|---|---|
| PubChem CID | 155268561 |
| Molecular Formula | C25H24Cl2N2O3S |
| Molecular Weight | 503.45 g/mol |
| Exact Mass | 502.09 |
| IUPAC Name | 3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-(2-methylpropyl)indol-5-yl]oxyaniline |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(CC(C)C)c3cc(Oc4c(Cl)cc(N)cc4Cl)ccc32)cc1 |
| InChI | InChI=1S/C25H24Cl2N2O3S/c1-15(2)10-17-14-29(33(30,31)20-7-4-16(3)5-8-20)24-9-6-19(13-21(17)24)32-25-22(26)11-18(28)12-23(25)27/h4-9,11-15H,10,28H2,1-3H3 |
| InChIKey | LUZIZPXEDZONTH-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.45 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|