C24H19Cl2F3N2O3S — CID 155268692
3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-(1,1,1-trifluoropropan-2-yl)indol-5-yl]oxyaniline (PubChem CID 155268692) has the molecular formula C24H19Cl2F3N2O3S and a molecular weight of 543.39 g/mol. Its IUPAC name is 3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-(1,1,1-trifluoropropan-2-yl)indol-5-yl]oxyaniline.
| Compound Name | 3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-(1,1,1-trifluoropropan-2-yl)indol-5-yl]oxyaniline |
|---|---|
| PubChem CID | 155268692 |
| Molecular Formula | C24H19Cl2F3N2O3S |
| Molecular Weight | 543.39 g/mol |
| Exact Mass | 542.04 |
| IUPAC Name | 3,5-dichloro-4-[1-(4-methylphenyl)sulfonyl-3-(1,1,1-trifluoropropan-2-yl)indol-5-yl]oxyaniline |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(C(C)C(F)(F)F)c3cc(Oc4c(Cl)cc(N)cc4Cl)ccc32)cc1 |
| InChI | InChI=1S/C24H19Cl2F3N2O3S/c1-13-3-6-17(7-4-13)35(32,33)31-12-19(14(2)24(27,28)29)18-11-16(5-8-22(18)31)34-23-20(25)9-15(30)10-21(23)26/h3-12,14H,30H2,1-2H3 |
| InChIKey | ULEGHYYGGFPADQ-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.39 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|