C23H23ClN2O7S — CID 101193921
methyl (2S)-3-[6-(2-chloroacetyl)-1-(4-methylphenyl)sulfonylindol-3-yl]-2-(methoxycarbonylamino)propanoate (PubChem CID 101193921) has the molecular formula C23H23ClN2O7S and a molecular weight of 506.96 g/mol. Its IUPAC name is methyl (2S)-3-[6-(2-chloroacetyl)-1-(4-methylphenyl)sulfonylindol-3-yl]-2-(methoxycarbonylamino)propanoate.
| Compound Name | methyl (2S)-3-[6-(2-chloroacetyl)-1-(4-methylphenyl)sulfonylindol-3-yl]-2-(methoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 101193921 |
| Molecular Formula | C23H23ClN2O7S |
| Molecular Weight | 506.96 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | methyl (2S)-3-[6-(2-chloroacetyl)-1-(4-methylphenyl)sulfonylindol-3-yl]-2-(methoxycarbonylamino)propanoate |
| SMILES | COC(=O)N[C@@H](Cc1cn(S(=O)(=O)c2ccc(C)cc2)c2cc(C(=O)CCl)ccc12)C(=O)OC |
| InChI | InChI=1S/C23H23ClN2O7S/c1-14-4-7-17(8-5-14)34(30,31)26-13-16(10-19(22(28)32-2)25-23(29)33-3)18-9-6-15(11-20(18)26)21(27)12-24/h4-9,11,13,19H,10,12H2,1-3H3,(H,25,29)/t19-/m0/s1 |
| InChIKey | BNBJWGDGKPYQBT-IBGZPJMESA-N |
| XLogP | 3.05 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.96 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|