C27H28N2O5S — CID 10074398
ethyl (2R)-3-[1-(benzenesulfonyl)-6-methoxyindol-3-yl]-2-(benzylamino)propanoate (PubChem CID 10074398) has the molecular formula C27H28N2O5S and a molecular weight of 492.60 g/mol. Its IUPAC name is ethyl (2R)-3-[1-(benzenesulfonyl)-6-methoxyindol-3-yl]-2-(benzylamino)propanoate.
| Compound Name | ethyl (2R)-3-[1-(benzenesulfonyl)-6-methoxyindol-3-yl]-2-(benzylamino)propanoate |
|---|---|
| PubChem CID | 10074398 |
| Molecular Formula | C27H28N2O5S |
| Molecular Weight | 492.60 g/mol |
| Exact Mass | 492.17 |
| IUPAC Name | ethyl (2R)-3-[1-(benzenesulfonyl)-6-methoxyindol-3-yl]-2-(benzylamino)propanoate |
| SMILES | CCOC(=O)[C@@H](Cc1cn(S(=O)(=O)c2ccccc2)c2cc(OC)ccc12)NCc1ccccc1 |
| InChI | InChI=1S/C27H28N2O5S/c1-3-34-27(30)25(28-18-20-10-6-4-7-11-20)16-21-19-29(26-17-22(33-2)14-15-24(21)26)35(31,32)23-12-8-5-9-13-23/h4-15,17,19,25,28H,3,16,18H2,1-2H3/t25-/m1/s1 |
| InChIKey | PRGODDQGXUKWEO-RUZDIDTESA-N |
| XLogP | 4.15 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.60 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |