C24H27N3O8S — CID 90443814
methyl (2R)-3-[1-(4-methylphenyl)sulfonyl-4-nitroindol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (PubChem CID 90443814) has the molecular formula C24H27N3O8S and a molecular weight of 517.56 g/mol. Its IUPAC name is methyl (2R)-3-[1-(4-methylphenyl)sulfonyl-4-nitroindol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate.
| Compound Name | methyl (2R)-3-[1-(4-methylphenyl)sulfonyl-4-nitroindol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| PubChem CID | 90443814 |
| Molecular Formula | C24H27N3O8S |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | methyl (2R)-3-[1-(4-methylphenyl)sulfonyl-4-nitroindol-3-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| SMILES | COC(=O)[C@@H](Cc1cn(S(=O)(=O)c2ccc(C)cc2)c2cccc([N+](=O)[O-])c12)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H27N3O8S/c1-15-9-11-17(12-10-15)36(32,33)26-14-16(21-19(26)7-6-8-20(21)27(30)31)13-18(22(28)34-5)25-23(29)35-24(2,3)4/h6-12,14,18H,13H2,1-5H3,(H,25,29)/t18-/m1/s1 |
| InChIKey | SDDSSWWRCKJFKC-GOSISDBHSA-N |
| XLogP | 3.70 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|