C16H18ClN3O4S — CID 67194314
1-(2-chlorophenyl)sulfonyl-3-hydroxy-4-(piperazin-1-ylmethyl)pyridin-2-one (PubChem CID 67194314) has the molecular formula C16H18ClN3O4S and a molecular weight of 383.86 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfonyl-3-hydroxy-4-(piperazin-1-ylmethyl)pyridin-2-one.
| Compound Name | 1-(2-chlorophenyl)sulfonyl-3-hydroxy-4-(piperazin-1-ylmethyl)pyridin-2-one |
|---|---|
| PubChem CID | 67194314 |
| Molecular Formula | C16H18ClN3O4S |
| Molecular Weight | 383.86 g/mol |
| Exact Mass | 383.07 |
| IUPAC Name | 1-(2-chlorophenyl)sulfonyl-3-hydroxy-4-(piperazin-1-ylmethyl)pyridin-2-one |
| SMILES | O=c1c(O)c(CN2CCNCC2)ccn1S(=O)(=O)c1ccccc1Cl |
| InChI | InChI=1S/C16H18ClN3O4S/c17-13-3-1-2-4-14(13)25(23,24)20-8-5-12(15(21)16(20)22)11-19-9-6-18-7-10-19/h1-5,8,18,21H,6-7,9-11H2 |
| InChIKey | FCGFMANOCYYOGI-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.86 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |