C19H24FN3O4 — CID 174654553
1-[(2-fluorophenyl)methyl]-3-hydroxy-4-(piperazin-1-ylmethyl)pyridin-2-one;methyl formate (PubChem CID 174654553) has the molecular formula C19H24FN3O4 and a molecular weight of 377.42 g/mol. Its IUPAC name is 1-[(2-fluorophenyl)methyl]-3-hydroxy-4-(piperazin-1-ylmethyl)pyridin-2-one;methyl formate.
| Compound Name | 1-[(2-fluorophenyl)methyl]-3-hydroxy-4-(piperazin-1-ylmethyl)pyridin-2-one;methyl formate |
|---|---|
| PubChem CID | 174654553 |
| Molecular Formula | C19H24FN3O4 |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | 1-[(2-fluorophenyl)methyl]-3-hydroxy-4-(piperazin-1-ylmethyl)pyridin-2-one;methyl formate |
| SMILES | COC=O.O=c1c(O)c(CN2CCNCC2)ccn1Cc1ccccc1F |
| InChI | InChI=1S/C17H20FN3O2.C2H4O2/c18-15-4-2-1-3-13(15)12-21-8-5-14(16(22)17(21)23)11-20-9-6-19-7-10-20;1-4-2-3/h1-5,8,19,22H,6-7,9-12H2;2H,1H3 |
| InChIKey | FVPSOMDAAAQRQD-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|