C18H20ClN3O4 — CID 159034296
[1-[(2-chlorophenyl)methyl]-3-hydroxy-2-oxo-4-pyridinyl]methyl piperazine-1-carboxylate (PubChem CID 159034296) has the molecular formula C18H20ClN3O4 and a molecular weight of 377.83 g/mol. Its IUPAC name is [1-[(2-chlorophenyl)methyl]-3-hydroxy-2-oxo-4-pyridinyl]methyl piperazine-1-carboxylate.
| Compound Name | [1-[(2-chlorophenyl)methyl]-3-hydroxy-2-oxo-4-pyridinyl]methyl piperazine-1-carboxylate |
|---|---|
| PubChem CID | 159034296 |
| Molecular Formula | C18H20ClN3O4 |
| Molecular Weight | 377.83 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | [1-[(2-chlorophenyl)methyl]-3-hydroxy-2-oxo-4-pyridinyl]methyl piperazine-1-carboxylate |
| SMILES | O=C(OCc1ccn(Cc2ccccc2Cl)c(=O)c1O)N1CCNCC1 |
| InChI | InChI=1S/C18H20ClN3O4/c19-15-4-2-1-3-13(15)11-22-8-5-14(16(23)17(22)24)12-26-18(25)21-9-6-20-7-10-21/h1-5,8,20,23H,6-7,9-12H2 |
| InChIKey | JVGMMHJIDMYLII-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.83 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |