C19H22ClN3O3 — CID 174703954
[1-[(2-chlorophenyl)methyl]-2-oxo-4-(piperazin-1-ylmethyl)-3-pyridinyl] acetate (PubChem CID 174703954) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is [1-[(2-chlorophenyl)methyl]-2-oxo-4-(piperazin-1-ylmethyl)-3-pyridinyl] acetate.
| Compound Name | [1-[(2-chlorophenyl)methyl]-2-oxo-4-(piperazin-1-ylmethyl)-3-pyridinyl] acetate |
|---|---|
| PubChem CID | 174703954 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [1-[(2-chlorophenyl)methyl]-2-oxo-4-(piperazin-1-ylmethyl)-3-pyridinyl] acetate |
| SMILES | CC(=O)Oc1c(CN2CCNCC2)ccn(Cc2ccccc2Cl)c1=O |
| InChI | InChI=1S/C19H22ClN3O3/c1-14(24)26-18-16(12-22-10-7-21-8-11-22)6-9-23(19(18)25)13-15-4-2-3-5-17(15)20/h2-6,9,21H,7-8,10-13H2,1H3 |
| InChIKey | NSAZKEFNMVYAED-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |