C20H19ClF2N2O2S — CID 158620437
1-(2-chlorophenyl)sulfonyl-3-(difluoromethyl)-4-piperidin-1-ylindole (PubChem CID 158620437) has the molecular formula C20H19ClF2N2O2S and a molecular weight of 424.90 g/mol. Its IUPAC name is 1-(2-chlorophenyl)sulfonyl-3-(difluoromethyl)-4-piperidin-1-ylindole.
| Compound Name | 1-(2-chlorophenyl)sulfonyl-3-(difluoromethyl)-4-piperidin-1-ylindole |
|---|---|
| PubChem CID | 158620437 |
| Molecular Formula | C20H19ClF2N2O2S |
| Molecular Weight | 424.90 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 1-(2-chlorophenyl)sulfonyl-3-(difluoromethyl)-4-piperidin-1-ylindole |
| SMILES | O=S(=O)(c1ccccc1Cl)n1cc(C(F)F)c2c(N3CCCCC3)cccc21 |
| InChI | InChI=1S/C20H19ClF2N2O2S/c21-15-7-2-3-10-18(15)28(26,27)25-13-14(20(22)23)19-16(8-6-9-17(19)25)24-11-4-1-5-12-24/h2-3,6-10,13,20H,1,4-5,11-12H2 |
| InChIKey | IXXCLLOEHOKTEQ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.90 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |