C21H21BrF2N2O2S — CID 162086301
6-bromo-3-(difluoromethyl)-1-(3-methylphenyl)sulfonyl-4-piperidin-1-ylindole (PubChem CID 162086301) has the molecular formula C21H21BrF2N2O2S and a molecular weight of 483.38 g/mol. Its IUPAC name is 6-bromo-3-(difluoromethyl)-1-(3-methylphenyl)sulfonyl-4-piperidin-1-ylindole.
| Compound Name | 6-bromo-3-(difluoromethyl)-1-(3-methylphenyl)sulfonyl-4-piperidin-1-ylindole |
|---|---|
| PubChem CID | 162086301 |
| Molecular Formula | C21H21BrF2N2O2S |
| Molecular Weight | 483.38 g/mol |
| Exact Mass | 482.05 |
| IUPAC Name | 6-bromo-3-(difluoromethyl)-1-(3-methylphenyl)sulfonyl-4-piperidin-1-ylindole |
| SMILES | Cc1cccc(S(=O)(=O)n2cc(C(F)F)c3c(N4CCCCC4)cc(Br)cc32)c1 |
| InChI | InChI=1S/C21H21BrF2N2O2S/c1-14-6-5-7-16(10-14)29(27,28)26-13-17(21(23)24)20-18(11-15(22)12-19(20)26)25-8-3-2-4-9-25/h5-7,10-13,21H,2-4,8-9H2,1H3 |
| InChIKey | OZVATGNEZTWFGN-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.38 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |