C21H21BrF2N2O3S — CID 122520136
6-bromo-3-(difluoromethyl)-1-(4-methoxy-3-piperidin-1-ylphenyl)sulfonylindole (PubChem CID 122520136) has the molecular formula C21H21BrF2N2O3S and a molecular weight of 499.38 g/mol. Its IUPAC name is 6-bromo-3-(difluoromethyl)-1-(4-methoxy-3-piperidin-1-ylphenyl)sulfonylindole.
| Compound Name | 6-bromo-3-(difluoromethyl)-1-(4-methoxy-3-piperidin-1-ylphenyl)sulfonylindole |
|---|---|
| PubChem CID | 122520136 |
| Molecular Formula | C21H21BrF2N2O3S |
| Molecular Weight | 499.38 g/mol |
| Exact Mass | 498.04 |
| IUPAC Name | 6-bromo-3-(difluoromethyl)-1-(4-methoxy-3-piperidin-1-ylphenyl)sulfonylindole |
| SMILES | COc1ccc(S(=O)(=O)n2cc(C(F)F)c3ccc(Br)cc32)cc1N1CCCCC1 |
| InChI | InChI=1S/C21H21BrF2N2O3S/c1-29-20-8-6-15(12-19(20)25-9-3-2-4-10-25)30(27,28)26-13-17(21(23)24)16-7-5-14(22)11-18(16)26/h5-8,11-13,21H,2-4,9-10H2,1H3 |
| InChIKey | HEAYISBWFSAZET-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.38 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |