C22H19Cl3F3N3O4S — CID 122506154
2,2,2-trichloro-1-[4-[5-[3-(difluoromethyl)-5-fluoroindol-1-yl]sulfonyl-2-methoxyphenyl]piperazin-1-yl]ethanone (PubChem CID 122506154) has the molecular formula C22H19Cl3F3N3O4S and a molecular weight of 584.83 g/mol. Its IUPAC name is 2,2,2-trichloro-1-[4-[5-[3-(difluoromethyl)-5-fluoroindol-1-yl]sulfonyl-2-methoxyphenyl]piperazin-1-yl]ethanone.
| Compound Name | 2,2,2-trichloro-1-[4-[5-[3-(difluoromethyl)-5-fluoroindol-1-yl]sulfonyl-2-methoxyphenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 122506154 |
| Molecular Formula | C22H19Cl3F3N3O4S |
| Molecular Weight | 584.83 g/mol |
| Exact Mass | 583.01 |
| IUPAC Name | 2,2,2-trichloro-1-[4-[5-[3-(difluoromethyl)-5-fluoroindol-1-yl]sulfonyl-2-methoxyphenyl]piperazin-1-yl]ethanone |
| SMILES | COc1ccc(S(=O)(=O)n2cc(C(F)F)c3cc(F)ccc32)cc1N1CCN(C(=O)C(Cl)(Cl)Cl)CC1 |
| InChI | InChI=1S/C22H19Cl3F3N3O4S/c1-35-19-5-3-14(11-18(19)29-6-8-30(9-7-29)21(32)22(23,24)25)36(33,34)31-12-16(20(27)28)15-10-13(26)2-4-17(15)31/h2-5,10-12,20H,6-9H2,1H3 |
| InChIKey | CFGURSGMEALYIV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 71.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.83 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|